Post on 26-Nov-2014
transcript
Formulas
Chemical formula is derived either from the ions or for non-metal compounds a
description within the name
Ions are combined to cancel out overall charge subscriptions indicate multiples for an ion.
Polyatomic ions are put into brackets
Eg. Sodium Chloride Magnesium Chloride Zinc Hydroxide
Na+ Cl- �NaCl Mg2+ Cl- �MgCl2 Zn2+ OH- � Zn(OH)2
Sulfur Dioxide Sulfur Trioxide
SO2 SO3
Equation
An equation shows the path of a chemical reaction. It consists of reactants going to
products. When writing equations the correct formula is written and then it is balanced
with mole coefficients. There are a number of common reaction types:
1. - Acids + Base � Salt + Water
- Bases are -Hydroxides/-Oxides
2. Acids + Carbonates � Salt + Water + Carbon Dioxide
3. Acid + Metal � Metal Salt + Hydrogen
4. Reactions with Oxygen � Oxides/Hydrocarbon + O2 + CO2 + H2O
Matter
- Matter consists of atoms/particles that fill and available space
- There is no matter in a vacuum
- Matter can divide into: - Mixtures: Combinations of particles that are not
chemically joined
- Pure Substances: Made up of only a single type of
particles: - Elements
- Compounds
States
Matter can exist in three main states (phases): - Solids (s)
- Liquid (aq)
- Gases (g)
At an atomic level energy (heat) and movement are proportional. ie more heat � More
movement. As a substance is heated the temperature raises then stops at its melting point
as the energy is used to overcome the force between particles once liquid its temperature
increases again
Properties
Properties are specific attributes for a compound physical propertied include:
- State and Density
- Operative including colour, size, etc.
- Conductivity
- Melting Point (mp) Boiling Point (bp)
- Solubility
Chemical properties include how a substance reacts with common chemicals such as:
- Oxygen, Acids, Bases, Oxidants and Reactants
Separations of Mixtures
A mixture of substance can be ‘easily’ separated by physical means. By using differences
in physical properties of the components they can be separated.
Separation Techniques:
- Filtering insoluble particles trapped in filter paper
- Decanting - Careful pouring off top liquid layer from two different density
substances
- Dissolving - separate soluble from insoluble substances
- Evaporating/Boiling/Crystallization where a soluble solid is recovered by
evaporating the solvent liquid
- Distillation - Used to separate liquid of different boiling points
- The lower boiling point (bp) fraction is evaporated out of the
solution and condensed to recover it
- Centrifuging - Use mass differences in a spinning machine (with centrifugal
force) to separate the heaviest components to the bottom
- Chromatography - Use differences in solubility to separate a mixture in a
moving solvent
Atomic Structure
Atoms make up all things they are tiny indivisible particles consisting of a central nucleus
of protons and neutrons, surrounded by negative electrons arranged in shells
The periodic table tells us information for each element (type of atom)
- Atomic number = # of Protons
- Mass number = # of Protons + # of Neutrons
- # of Electrons = # of Protons
Isotopes are elements/atoms with a different number of neutrons so different mass
number:
Eg. - Carbon-14 (14C) & Carbon-12 (12C)
- Oxygen-16 (16O) & Oxygen-18 (18O)
- Hydrogen (1H)
Electron Configuration
Electrons are arranged in shells surrounding the nucleus. The shells fill in order from
inside first. The max number of electrons is:
1st Shell: - 2 electrons
2nd Shell: - 8 electrons
3rd Shell: - 8 electrons
4th Shell: - 18 electrons
Each shell corresponds to a period on the periodic table. The notation used is element
symbol ten the number of electrons in each shell:
Eg. H: 1
He: 2
O: 2,6
Mg: 2,8,2
K: 2,8,8,1
Ca: 2,8,8,2
Ions
An ion is a particle that has lost or gained electrons to become charged positive ions are
cations, negative ions are anions. Simple monatomic ions form from elements losing or
gaining elections to achieve the stability of a complete outer shell thus, noble gasses do
not form ions. Metals lose elections to become cations. Non-metals gain electrons to
become anions.
Eg. Mg: 2,8,2 will lose 2 outer electrons to be Mg2+: 2,8
N: 2,5 will gain 3 extra electrons to fill its outer shell N3-: 2,8
Elements in the same group from the same charge ions:
Eg. Group 1 all +1
Group 2 all +2
Group 17 all -17
Group 16 all -16
Bonding
Elements undertake chemical bonding to enable a stable electron arrangement to form
There are 3 forms of bonding available:
1. Metallic bonding occurs between metal atoms only:
A metal atom’s valence or outer shell electrons are delocalized into the
metal 3D structure
Metallic Bonding
The structure is a 3D lattice (network) of positive nuclei kernel in a ’sea’
of delocalized valence electrons.
The structure of substance leads to its properties:
- Strong substances, they have high melting points and boiling
points due to the 3D lattice structure and strong attraction between
positive kernels and surrounding electrons
- Conduct electricity due to mobile electron in structure
- Malleable (beaten into sheet) ductile (drawn into wire)
- Shiny when scratched
2. Ionic Bonding:
Occurs between metal and non-metal elements. Electrons are transferred
from metals forming cations to non-metals forming anions. Then a 3D
network of oppositely charged ions with strong electrostatic attraction
forms
Ionic Compound properties:
- High melting and boiling points due to 3D network lattice structure, it
requires high energy to overcome the electrostatic attractions surrounding
an ion. Eg. NaCl = 801°c
- Do not conduct as solids, but do as liquids/molten or aqueous solutions
as the ions are free to move and carry charge.
- Hard but brittle substance due to lattice imperfections creating cleavage
planes
3. Covalent Bonding
This occurs between non-metal elements and involves sharing electrons to
enable atoms to have access to a full valence shell for stability
Covalent Bonding can form two different types of substances:
1. Network or extended lattice structures:
- Strong bonds in 2 or 3 dimensions
- Very strong, high melting and boiling points, hard
substances
- Insoluble and usually do not conduct (except
graphite)
2. Covalent Molecules
Covalent bonding can form individual discrete molecules. These
can be non-polar or polar
Non-Polar Bonding:
As a Substance:
- Very weak force between non-polar molecules
- Very low melting and boiling points due to weak
forces
- Non-conductors - no free ions or electrons to
carry charge
- Insoluble and immiscible in water
- Individual discrete molecules up of a few covalently
bonded atoms
Polar Molecules:
When two different elements covalently bond, the difference in
electronegativity causes an unequal sharing of bonding electrons,
so a polar bond
Electronegativity - an atom’s ability to attract and hold electron
from a bond
A polar bond can create a polar molecule. However, several polar
bonds may cancel out in a symmetrical molecule to make the
overall non-polar
- Melting and boiling points rose due to increased attractions
- Small molecules are weakly soluble
Lewis Diagrams
Lewis or Electron Dot Diagrams show how a molecule is bonded and can be used to a
certain shape
- Only show valence electrons
To Draw:
1. Put elements with the least number of electrons in the centre
2. Draw valence electrons on each four points of compass, single then
pairs
3. Form bonding pairs from leftover single electrons
4. Resolve diagram for neatness and even spacing between bonds and lone
electron pairs, and check for octet rule:
- elements need 8 electrons except Hydrogen
Types of Reactions
There are four types of chemical reactions:
- Precipitation
- Decomposition
- Oxidation - Reduction (Redox)
- Neutralization (Acid-Base)
Eg. Acid + - Hydroxide
- Oxide
- Carbonate
Precipitation (ppt)
A precipitation is a solid that is formed from a reaction of two aqueous solutions. Things
form a precipitation if a product from a reaction is insoluble.
Eg. Copper Sulfate + Sodium Hydroxide � Copper Hydroxide + Sodium Sulfate
Solubility Rules:
1. All group 1 (Na+, K+, Li+), Nitrate (NO3-) and Ammonium (NH4
+) compounds
are soluble
2. All Chlorides are soluble, except for Silver Chloride (AgCl) and Lead Chloride
(PbCl2+)
3. All Sulfates are soluble, except for Barium Sulfate (BaSO4), Lead Sulfate
(PbSO4) and Calcium Sulfate (CaSO4)
4. All Carbonates are insoluble except for ones in Rule 1
5. All Hydroxides are insoluble except for ones in Rule 1
Precipitation Equation
The precipitate that forms from mixing two solution is the reaction that occurring. The
other ions are spectator ions - they are not involved therefore an ionic equation is written
that omits spectators.
Eg. NiCl2(aq) + 2KOH(aq) � 2KCl(aq) + Ni(OH)2(s)
Ni2+(aq) + 2OH(aq) � Ni(OH)2(s)
Complexes
Complexes are soluble ions made from addition of excess of a reagent (chemicals). They
are used of for confirmation testing of unknown ions
Complex ions to remember:
1. [Cu(NH3)4]2+ � Copper tetra amine - Royal Blue
2. [Zn(OH)4]2+ � Zincate - Colourless
3. [Zn(NH3)4]2+ � Zinc tetra amine - Colourless
4. [Al(OH)4] � Aluminate - Colourless
5. [FeSCN]2+ � Iron (III) Thioscyanate - Blood Red
Unknown Identification
Solutions where the ions are unknown can be identified using precipitation reactions.
Each cations and anion must be identified separately. To bring about known, precipitation
reactions reagents are used.
Common Reactions:
- Sodium Hydroxide - Forms characteristic coloured precipitations
- Some complexes with cations
- Ammonia Solution - For making amino complexes for confirmation
- Barium Nitrate/Chloride - Identify Sulfates
- Silver Nitrate - Identify Chlorides
- Dilute Acid (HNO3) - Identify Carbonates
Decomposition (Thermal)
Decomposition is when one compound breaks into several compounds
A�B + C (D, etc)
Thermal decomposition is when this process occurs during heating. The products of
decomposition depend upon what it is
Types:
Metal Carbonate:
Forms CO2 + Metal Oxide Products
Eg. CaCO3 � CO2 + CaO
MgCO3 � CO2 + MgO
Na2CO3 � CO2 + Na2O
The limewater test confirms CO2
Metal Bicarbonate/Hydrogen Carbonate:
Forms Metal Carbonate + H2O + CO2
Eg. 2NaHCO3 � Na2CO3 + H2O + CO2
Ca(HCO3)2 � CaCO3 + H2O + CO2
Metal Hydroxide:
These decompose to form the Metal Oxide + H2O
Eg. Mg(OH)2 � MgO + H2O
2NaOH � Na2O + H2O
Metal Sulfates:
Decompose to form Metal Oxide and Sulfur Dioxide (which
usually gets further oxides to form Sulfur Trioxide)
Eg. MgSO4 � MgO + SO2
Oxidation - Reduction (Redox)
These are chemical reactions that involve the transfer of elections. Both oxidation and
reduction must occur at the same time.
L - Loss
E - Electrons
O - Oxidation
The Lion Goes
G - Gain
E - Electrons
R - Reduction
Oxidation may also be seen by:
- The gain of Oxygen element
- The loss of Hydrogen element
Eg. C + O2 � CO2 the C is oxidized
Reduction may also be seen by:
- The loss of Oxygen element
- The gain of Hydrogen element
Eg. 2PbO + C � 2Pb + CO2
Anytime there is a metal as its element in the reactants
or products of a reaction then redox has occurred
Eg. 2Mg + O2 � 2MgO Mg is oxidized as it:
- gained Oxygen
- lost Electrons
O2 is reduced as it changed to O2- so gained electrons
Oxidations is the addition of Oxygen to an element or compound
Reduction is the addition of Hydrogen to an element or compound
Oxidation is the removal of electron(s) from a particle in a reaction
Reduction is the addition of electron(s) to a particle in a reaction
The Mole
In chemistry very large amounts of particles are reacting are in a given reaction. Even
very accurate balances (scales) will be weighing trillions of atoms. The mole is a name
given to a large quantity of 6.023x1023 =1mol (Avogadro’s Number)
1mol of Fe = 6.023x1023 Atoms
0.5mol of Fe = 3.011x1023 Atoms
1mol CO2 = 6.023x1023 Molecules of CO2 ≡ 3mols of atoms (1C + 2O)
To relate to mass the relative Atomic masses (Ar) or Molar masses (M) on the periodic
table become 1mole of an element
Eg. 1mol of K will weigh 39.0g
31.6g of Cu will be 5mol
For compounds the molar mass of molecular mass must be found first by summing all the
masses for each element
M(CO2) = 12 + 2(16) = 44
M(Fe) =55.5
Mole Calculations
The relationship between molar mass (M), mass (m) and number of moles or amount of a
substance (n) are:
M � Molar mass (gmol-1) � M=m/n
m � Mass in grams (g) � m=Mxn
n � Number of moles in mol � n=m/M
Eg. 18.2g of Magnesium
n(Mg)=m/M=18.2/24.3 =0.749mol
1.6g of SO2
n(SO2)=m/M=4.2/136.4 =0.0308
1.63mol of Ammonium Sulfate
m((NH4)2S)=mxM=1.63x68 =111g
0.00489mol of Magnesium Sulfate Heptahedrate
m(MgSO4 • 7H2O)=mxM=0.00489x246.3 =1.20g
Mass to Mass
To calculate find an unknown mass for a species in a reaction from the mass of a different
species, mole is used
Eg. H2SO4 + Mg � MgSO4 + H2
If 17.2g of Mg is used what mass of MgSO4 is formed
3 steps:
1. Find the number of moles of the known species n(known)
n(Mg)=m/M=17.2/24.3=0.708mol
2. Use the equation’s mole ratio to fin the number moles for unknown n(unknown)
n(MgSO4)=n(Mg)=0.708mol
3. Find the mass of your unknown m(unknown)
m(MgSO4)=nxM=0.708x120.4=85.2g(3sf)
What mass of Sulfuric Acid is required to make 27.4g of Zinc Sulfate from Zinc Metal
H2SO4 + Zn � ZnSO4 + H2
1. n(ZnSO4)=m/M=27.4/161.4=0.170mol
2. n(H2SO4)=n(ZnSO4)=0.170mol
3. m(H2SO4)=nxM=0.170x98.1=16.7g
11.3g of coal (C) is combusted, what mass of Carbon Dioxide is produced
C + O2 � CO2
1. n(C)=m/M=11.3/12=0.942mol
2. n(CO2)=n(C)=0.942mol
3. m(CO2)=nxM=0.942x44=41.4g
24.6g of Sodium Bicarbonate is reacted with what mass of Hydrochloric Acid
2HCl + 2NaHCO3 � 2NaCl + H2O + 2CO2
1. n(NaCHO3)=m/M=246/84=0.293mol
2. n(HCl)=n(NaCHO3)=0.293mol
3. m(HCl)=nxM=0.2293x36.5=10.7g (3sf)
Non 1:1 Ratios
When the mole ratio in question is not 1:1 we multiply the n(known) by unknown/known
mole ratio in Step 2
Eg. What mass of Magnesium will react with 14.3g of Hydrochloric Acid
Mg + 2HCl � MgCl2 + H2
1. n(known)
n(HCl)=m/M=14.3/36.5=0.392mol
2. n(unknown) from the equation ratio
n(Mg)=1/2xn(HCl)=1/2x0.392=0.196mol
3. m(unknown)=nxM=0.196x24.3=4.76g (3sf)
If 8.63g of Sodium Sulfate is produced what mass of Sodium is used
H2SO4 +2Na � Na2SO4 + H2
1. n(Na2SO4)=m/M=8.63/142=0.0608mol
2. n(Na)=2/1xn(H2SO4)=2x0.0608=0.122mol
3. m(unknown)=nxM=1.22x23=2.80g (3sf)
What mass of Carbon Dioxide is produced from 1.63g of Nitric Acid with
Magnesium Carbonate
MgCO3 + 2HNO3 � Mg(NO3)2 + CO2 +H2O
1. n(HNO3)=m/M=1.63/63= 0.026mol
2. n(CO3)=1/2xn(HNO3)=1/2x0.026=0.0129mol
3. m(unknown)=nxM=0.0129x44=0.569g (3sf)
What mass of Iron (III) Oxide is required to react with 186g of Hydrochloric Acid
Fe2O3 + 6HCl � 2FeCl3 + 3H2O
x/159.6 = 186/219(=36.5x6)
x=29685.6/219
x=135.55
x=136 (3sf)
1. n(HCl)=m/M=186/36.5=5.10mol
2. n(Fe2O3)=1/6xn(HCl)=1/6x5.10=0.8493mol
3. m(unknown)=nxM=0.8492x159.8=136 (3sf)
Percent for Composition
The percent of composition for a compound tells us the contribution to the total mass
from each element
Step 1. Find the molar mass for the compound
2. Divide each elements contribution by the total and then multiply by 100
Eg. BaCl2 • 2H2O
M(BaCl2 • 2H2O)= 137.3 + 35.5(2) + 1(4) + 16
=228.3
Ba=137.3/228.3 x100= 60.14
Cl=71/228.3 x100= 31.1
H=4/228.3 x100= 1.75
O=16/228.3 x100= 7
99.998%
Empirical Formulas
An Empirical formula is the simplest ratio of elements in a compound. A molecular
formula is the actual ratio
Eg. Empirical Formula � Molecular Formula
CH3 � C2H6
MgSO4 � MgSO4
CH2O � C6H12O6
The molar mass and percentage of composition of unknown compounds can be found
from mass spectrometers. This information is used to find empirical and molecular
formulas
Step 1. Assure you have 100g of the substance, then all percentages becomes mass
2. Divide each element’s mass by its molar mass
3. Divide all answers from 2 by the smallest one
4. Judge the numbers to a whole number.
5. Find the ratio of empirical formula Mr to given Mr to get a multiplier from the
molecular formula
Eg. An unknown has Mr=180, 40% C, 6.7% H and 53% O
40g C, 6.7g H, 53g O
C = 40/12=3.33 � 3.33/3.31 ≈ 1
H = 6.7/1=6.7 � 6.7/3.31 ≈ 2
O = 53/16=3.31 � 3.31/3.31 ≈ 1
M(CH2O)=30, Ratio =180/30=6=Multiplier
So the molecular formula is C6H12O6 (=6[C1H2O1])
Water Crystallization
When a solution is evaporated to form crystals, water molecules become trapped in the
spaces within the crystal lattice. The amount of waters to the salt is in ratio in a hydrated
salt. (Eg. CuSO4 • 5 H2O has 5 waters per CuSO4)
By using gravimetric analysis (accurate weighing) we can determine what that ratio is and
deduce the formula of the hydrated salt.
Step 1. Find the amount of Water
2. Find the amount of anhydrous salt
3. Divide the answers by the smallest to get a whole number ratio
Eg. A hydrated sample of Barium Chloride is heated to determine the waters of
crystallization
Mass BaCl2 • xH2O=4.862g
Mass after heating =4.146g
1. m(H2O)= 4.862-4.146=0.716g
n(H2O)=m/M=0.716/18=0.0398mol
2. m(BaCl2)=4.16g
n(BaCl2)=m/M=4.146/208.3=0.0199mol
3. 0.0199/0.0199:0.0398/0.0199=1:2
So the hydrated formula is:
BaCl2 • 2H2O
Non-Metals
Non-metals elements are located on the right of the periodic table’s zigzag. They have
different properties to metals:
- Generally do not conduct (except graphite)
- Have much lower melting and boiling points, except diamond and quartz (SiO2)
- Are more often molecular structures rather than extended lattices
- Often have different colours and are non-shiny
- They form acidic compounds (metals then to form alkali compounds)
Oxygen
Oxygen forms a diatomic gas as an element. It has a melting point of -206°c and a boiling
point of -186°c. Oxygen’s density = 0.0032 gcm3. An allotrope (different physical form of
same element in same state) of oxygen is Ozone (O3)
Ozone is a dangerous respirator irritant in low levels. Often produce by electrical spark or
UV light. Its pale blue and sweet sickly smelling.
The ozone layer filters dangerous UVA and UVB light by absorption. Excessive CFCs
has caused a depletion of O3, thus creating the ‘Ozone Hole.’
Commercial production of Oxygen and Nitrogen gas
Air is cooled and compressed several times followed by an adiabatic expansion.
Air consists of a number of gasses including N2, H2, O2, H2O, CO2 and Nobel gasses Ar,
Ne etc.
The liquid air is allowed to warm slightly to boil off the O2 and recondensed, thus N2 and
O2 are obtained by the fraction distillation of liquid air, O2 production in the lab.
O2 is made in the lab from decomposition of various substances
1. Hydrogen Peroxide with Manganese Dioxide Catalyst
2H2O2 � 2H2O + O2
2. Heating Potassium Permanganate
2KMnO4 � 2KMnO3 + O2
Nitrogen
N2 is a clear colourless gas with a melting point of -210°c and a boiling point of -196°c.
Its density = 0.808 gcm3. It consists of a diatomic molecule with a strong triple bond. This
makes it generally uncreative as a substance and is often used as an iner carriergass or as
a liquid for cryogenics and super cooling.
Nitrogen is made commercially by the fractional distillation of liquid air. In the lab it’s
made by heating Sodium Nitrate with Ammonium Chloride.
NH4Cl + NaNO2 � NaCl + NH4 NO2
The Ammonium Nitrate then decomposes
NH4NO2 � N2 + 2H2O
Nitrogen is an essential element in plant (and animal) growth for making proteins. To
obtain nitrogen plants require soluble nitrates (NO3-) which can be uptake from the soil.
Nitrogen is ‘fixed’ to nitrates by: - Lightning
- Nitrogen fixing bacteria in legumes plants
- Addition of Ammonium or Nitrate based fertilizer
- Decaying of dead organisms releases some
Nitrates and also denitrifying bacteria release N2 to
the air
Nitrogen Oxides
Nitrogen car reacts with oxygen with the presence of an electrical discharge (spark).
Mostly in lightning strikes (N2 fixing) but also large amounts inside car engines.
Commonly known as NOx there are three main forms:
1. Nitrous Oxide (N2O).
N2O is also known and used as laughing gas, or a commonly use
anaesthetic. Can ve made in the lab by decomposing Ammonium Nitrate
NH4NO3 � N2O + 2H2O
2. Nitric Oxide (NO)
Colourless gas that immediately oxidises in air to NO2, made from
reactions of Dilute Nitric Acid with Copper Metal
3Cu + 8HNO3 � 3Cu(NO3)2 + 2NO + 4H2O
3. Nitrogen Dioxide (NO2)
Dense brown pungent gas that sinks into low lying areas. Made from
Concentrated Nitric Acid and Copper Metal
Cu + 4cHNO3 � Cu(NO3)2 + 2 NO2 + 2H2O
NO2 is an acid gas that reacts by hydrolysis in water
2NO2(g) + H2O � HNO2 + HNO3
HNO2 = Nitrous Acid
HNO3 = Nitric Acid
In areas with significant vehicle congestion, then NO2 causes acid rain and
Photochemical Smog
Acid Rain: - Damages buildings and structures
- Causes skin irritations in animals
- Destroys leaf foliage on plants
- Lowers pH of soil and waterways, often killing life
Photochemical Smog: - Brown haze in valleys or low lying areas
- NO2 will react with Oxygen molecules, catalysed by
sunlight to produce ozone
O3: - Respiratory irritant
- Damages eye tissue
- Some crop/plant damages
However - NO2 can be useful to plants as it produces nitrates (from HNO3) which
are needed to make protein for growth
Ammonia
Ammonia NH3 is a pungent colourless gas. That is denser than air. Ammonia acts as a
base and reacts with water to form Ammonium Hydroxide:
NH3 + H2O � NH4OH
Ammonia is detected by: - Damp Red Litmus � Turns Blue
- White smoke when reacted with HCl vapour
NH3 + HCl � NH4Cl (white)
Ammonia is produced in the lab by heating an Ammonium Salt with a strong Alkali
NH4Cl + Ca(OH)2 � CaCl2 + 2H2O + 2NH3
Ammonia vapour is very soluble and will generate a vacuum over water
Haber Process
Ammonia is produced commercially by the Haber Process. The raw materials are
Methane gas and Water.
Step 1 - CH4 and Water are steam reformed to make synthesis gas
CH4 + H2O � CO + 3H2
Synthesis Gas
Step 2 - Air (mix of O2 and N2) is added to the mixture. This further reacts with
the CO and some of the H2
CO + O2 � CO2 - Removed for later use
2H2 + O2 � H2O - Recycled back into Step 1
Now reaction mixture contains leftover H2, and unreacted N2
Step 3 - The ‘Haber Step’, the N2 and H2 is brought together in 1:3 ratio over an
Iron III Oxide catalyst
N2(g) + 3H2(g) (Fe2O3)� 2NH3(g)
Ammonia is mostly used for fertiliser
Eg. - Reacted with CO2 from Step 2
2NH3 + CO2 � NH2CONH2 + H2O
- Bubbled through Sulfuric Acid
2NH3 + H2SO4 � NH4SO4 - Ammonium Sulfate
- Bubbled through Nitric Acid
NH3 +HNO3 � NH4NO3 - Ammonium Nitrate
Ammonia through Ammonium Nitrate is also used to make explosives such as artillery
shells and bombs
NH3 also used: - For a Refrigerant
- As a household cleaner
- Manufacture of dyes and nylon
Sulfur
Sulfur is a yellow powder at room temperature. It is insoluble in water but will dissolve in
non-polar solvents such as Carbon Disulfide. It has a mp=112°c and bp=445°c. Sulfur
exists as an S8 molecule in a ‘puckered’ ring shape
It has two allotropes: - Rhombic Sulfur up to 96°c
- Monoclinic Sulfur from 96-112°c
And a third from of ‘Plastic Sulfur’ when molten, where the rings open and form
long entangled chains. This is flexible like plastic
Sulfur Extraction
Sulfur occurs naturally around volcanic areas and as impurities in fossil fuels
It can be extracted: - By open mining
- Frasch process which uses super heated steam to drive liquid S
from underground deposits
- Obtained by reducing H2S impurities in natural gas.
Sulfur Reactions:
- Sulfur reactions with Metals to form Metal Sulfides
Eg. 2Ag + S � Ag2S - Silver Tarnish
2Fe + 3S � Fe2S3
Zn + S � ZnS - Yellow Powder
Metals Sulfides easily react with Acids to make dangerous H2S, rotten egg smells toxic
gas
- Sulfur burns with a blue flame to form Sulfur Dioxide molecules in Oxygen
S + O2 � SO2
This is reactive as it’s unstable, but partly stabilised by resonance
Sulfur Dioxide
Sulfur Dioxide SO2 can be prepared in the lap from reactions pf a Sulfur Salt
Na2SO3 + 2HCl � 2NaCl + H2O + SO2
As it is more dense than air it is collected by upwards displacement of air
Large amounts of SO2 are produced in industries from impurities in fossil fuels that are
burnt for energy
SO2 is soluble in water to produce Sulfurous Acid
SO2 +H2O � H2SO4 - Sulfurous Acid
This causes Sulfur based acid rain in areas with large industry
This causes - Damage to buildings/concrete
- Skin irritations to animals/humans
- Foliage damage to plants
- Acidifying soil and waterways
There is no gain from Sulfur based acid rain unlike Nitrogen based acid rain
Uses of SO2 - As a sterilant for bottles and food containers, often used in the
form of Metabisulfite
- To prevent food spoiling in transport, SO2 kills bacteria and also
is a Reductant, so prevents oxidation of fruit etc
- Bleaching in some paper mills
- For the manufacturing of Sulfuric Acid
Sulfuric Acid
H2SO4 is a strong diprotic inorganic acid. It is at maximum strength at approximately
70% when there is full Disassociation (splits into ions)
H2SO4 � H+ + HSO-4 � 2H+ + SO-
4
(�) = H2O
So overall: H2SO4(l) + 2H2O(l) � 2H3O+
(aq) + SO2-4(aq)
Sulfuric Acid at 99% has not dissociated so is non-acidic and can be stored in mild steel
vessels. It is a strong dehydrating agent and will remove water molecules from most
substances
Industrial Manufacture - The Contact Process
Sulfuric Acid is manufactured by the millions of tonnes, mostly for fertilizer
Step 1 - Sulfur is vaporised and combusts instantly on ’contact’ with air
S(g) + O2(g) � SO2(g)
Step 2 - The SO2 is further oxidised over a Vanadium Pent oxide (V2O5) catalyst
bed at 450°c
2SO2 + O2 � 2SO3
Step 3 - The SO3 is dissolved into concentrated Sulfuric Acid to make Oleum
SO3 + H2SO4 � H2S2O7 - Oleum
It cannot be dissolved directly in water as it is exothermic forming an
useable fog
Step 4 - The Oleum is diluted to make 98% H2SO4
H2S2O7 � 2H2SO4
Most H2SO4 is made into Superphosphate by reacting with insoluble rock
Phosphate/Calcium Phosphate. This is done to make a soluble source of
Phosphate
H2O + Ca3(PO4)2 + H2SO4 � CaSO4 • 2H2O + Ca(H2PO4)2
CaSO4 • 2H2O + Ca(H2PO4)2 - Superphosphate
Chlorine
Chlorine is a yellow-green acidic gas that is denser than air. It exists as a diatomic
molecule. Its mp= -101°c, bp= -35°c and density= 1.56 gcm-3. Chlorine is quite soluble in
water to for two acids by hydrolysis
Cl2 + H2O � HClO + HCl - Hypochlorous Acid + Hydrochloric
Cl2 is a very strong oxidant and will react with most substance like, metals including inert
ones, non-metals and common reductants eg SO2-4
Lab Production
It is made by oxidising concentrated HCl with KMnO4 (Potassium Permanganate) or
MnO2 (Manganese Dioxide) with heat
2KMnO4 + 16HCl � 2KCl + 2MnCl2 + 8H2O + 5O2
Cl2 supports combustion eg. 2Fe + 3Cl2 �2FeCl3
Cl2 is produced commercially by electrolysis using The Membrane Cell
Uses of Chlorine (Cl2)
Chlorine is mostly used in the production of Hydrogen Chloride (HCl) by Synthesis
Reaction
H2(g) + Cl2(g) � 2HCl(g)
In water this is Hydrochloric Acid
HCl(g) + H2O � H3O+ + Cl-
Cl2 is also heavily used in the pulp and paper industry to bleach colour from paper pulp
Other uses include: - Purifying water by sterilising and killing bacteria
- Manufacture of ‘Chlorine’ bleaches for commercial
cleaning/bleaching of cloth
- To make plastics such as PVC
- Solvents, pesticides and aerosol propellants (CFC)
Hypochlorite ion (OCl-)
OCl- has similar properties to chlorine but is in a much more usable form. It is present is
chlorine water from the Hypochlorous Acid
HOCl � H+ + OCl-
Also made by bubbling Cl2 through a base
With Sodium Hydroxide � Sodium Hypochlorite
2NaOH + Cl2 � NaCl + NaOCl + H2O
- Household cleaners and bleaching powder
With Calcium Hydroxide � Calcium Hypochlorite
2Ca(OH)2 + 2Cl2 � CaCl2 + Ca(OCl)2 + 2H2O
- Used for pool chlorine and drinking water in low concentrations
Hydrogen Chloride
HCl(g) is a polar molecule, It has a dipole across the bond and therefore over the molecule.
The permanent dipole interactions raise its mp and bp alone that the equidistant non-polar
molecules.
In water it forms Hydrochloric Acid
HCl(g) + H2O � H3O+ + Cl-
It’s very in water (like ammonia) causing a vacuum over water surface and detect for, by
a white smoke forming with one ammonia.
To make in industry � Synthesis
To make in the lab react Concentrated Sulfuric Acid with a Chloride Salt
H2SO4 + NaCl � HCl + NaHSO4
Beam.A